C21H23IN2O4 — CID 86270146
[(4R,7S,7aR)-7-acetamido-11-iodo-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 86270146) has the molecular formula C21H23IN2O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is [(4R,7S,7aR)-7-acetamido-11-iodo-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,7S,7aR)-7-acetamido-11-iodo-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 86270146 |
| Molecular Formula | C21H23IN2O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | [(4R,7S,7aR)-7-acetamido-11-iodo-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)N[C@H]1C=CC2[C@H]3Cc4c(I)cc(OC(C)=O)c5c4C2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C21H23IN2O4/c1-10(25)23-15-5-4-13-16-8-12-14(22)9-17(27-11(2)26)19-18(12)21(13,20(15)28-19)6-7-24(16)3/h4-5,9,13,15-16,20H,6-8H2,1-3H3,(H,23,25)/t13?,15-,16+,20-,21?/m0/s1 |
| InChIKey | WXGKDLPHEQGHLN-TUKPMEJESA-N |
| XLogP | 2.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|