C22H28N2O4 — CID 138648193
[(7S)-9-ethoxy-3-methyl-11-(methylamino)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 138648193) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(7S)-9-ethoxy-3-methyl-11-(methylamino)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(7S)-9-ethoxy-3-methyl-11-(methylamino)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 138648193 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(7S)-9-ethoxy-3-methyl-11-(methylamino)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | CCOc1cc(NC)c2c3c1OC1[C@@H](OC(C)=O)C=CC4C(C2)N(C)CCC341 |
| InChI | InChI=1S/C22H28N2O4/c1-5-26-18-11-15(23-3)13-10-16-14-6-7-17(27-12(2)25)21-22(14,8-9-24(16)4)19(13)20(18)28-21/h6-7,11,14,16-17,21,23H,5,8-10H2,1-4H3/t14?,16?,17-,21?,22?/m0/s1 |
| InChIKey | SHIIMTSEUGVSKB-KAXGDRFQSA-N |
| XLogP | 2.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|