C19H21NO3 — CID 177116767
(3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate (PubChem CID 177116767) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate.
| Compound Name | (3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate |
|---|---|
| PubChem CID | 177116767 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate |
| SMILES | CC(=O)OC1C=CC2C3Cc4cccc5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C19H21NO3/c1-11(21)22-16-7-6-13-14-10-12-4-3-5-15-17(12)19(13,18(16)23-15)8-9-20(14)2/h3-7,13-14,16,18H,8-10H2,1-2H3 |
| InChIKey | GHLOKQFHAXIZJS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|