C24H22FNO4 — CID 154175761
[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-fluorobenzoate (PubChem CID 154175761) has the molecular formula C24H22FNO4 and a molecular weight of 407.44 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-fluorobenzoate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 154175761 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-fluorobenzoate |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](OC(=O)c2ccc(F)cc2)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C24H22FNO4/c1-26-11-10-24-16-7-9-19(29-23(28)13-2-5-15(25)6-3-13)22(24)30-21-18(27)8-4-14(20(21)24)12-17(16)26/h2-9,16-17,19,22,27H,10-12H2,1H3/t16-,17+,19-,22-,24-/m0/s1 |
| InChIKey | PTLSRBXFGNTNMZ-MJFIPZRTSA-N |
| XLogP | 3.20 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|