C19H20N2O7 — CID 11703761
[(4R,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-nitrooxyacetate (PubChem CID 11703761) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [(4R,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-nitrooxyacetate.
| Compound Name | [(4R,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-nitrooxyacetate |
|---|---|
| PubChem CID | 11703761 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(4R,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-nitrooxyacetate |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](OC(=O)CO[N+](=O)[O-])C=CC3[C@H]1C5 |
| InChI | InChI=1S/C19H20N2O7/c1-20-7-6-19-11-3-5-14(27-15(23)9-26-21(24)25)18(19)28-17-13(22)4-2-10(16(17)19)8-12(11)20/h2-5,11-12,14,18,22H,6-9H2,1H3/t11?,12-,14+,18+,19+/m1/s1 |
| InChIKey | ZRPGPZUEDBONOC-OKFOHUPSSA-N |
| XLogP | 0.96 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|