C18H21NO2 — CID 58136194
(7aR,12bS)-7-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 58136194) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (7aR,12bS)-7-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (7aR,12bS)-7-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 58136194 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (7aR,12bS)-7-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COC1C=CC2C3Cc4cccc5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C18H21NO2/c1-19-9-8-18-12-6-7-15(20-2)17(18)21-14-5-3-4-11(16(14)18)10-13(12)19/h3-7,12-13,15,17H,8-10H2,1-2H3/t12?,13?,15?,17-,18-/m0/s1 |
| InChIKey | ZIHGIGZTNHEOII-HMGVARAJSA-N |
| XLogP | 2.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|