C17H19NO — CID 118569030
(4R,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 118569030) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (4R,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 118569030 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4R,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | CN1CC[C@]23c4c5cccc4OC2CC=CC3[C@H]1C5 |
| InChI | InChI=1S/C17H19NO/c1-18-9-8-17-12-5-3-7-15(17)19-14-6-2-4-11(16(14)17)10-13(12)18/h2-6,12-13,15H,7-10H2,1H3/t12?,13-,15?,17-/m1/s1 |
| InChIKey | ATGJHNQTQQMHOU-YHTQSWCFSA-N |
| XLogP | 2.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|