C17H20ClNO2 — CID 90668598
(4R,4aR,7aR,12bS)-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride (PubChem CID 90668598) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is (4R,4aR,7aR,12bS)-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride.
| Compound Name | (4R,4aR,7aR,12bS)-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
|---|---|
| PubChem CID | 90668598 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (4R,4aR,7aR,12bS)-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
| SMILES | CN1CC[C@]23c4c5cccc4O[C@H]2C(=O)CC[C@H]3[C@H]1C5.Cl |
| InChI | InChI=1S/C17H19NO2.ClH/c1-18-8-7-17-11-5-6-13(19)16(17)20-14-4-2-3-10(15(14)17)9-12(11)18;/h2-4,11-12,16H,5-9H2,1H3;1H/t11-,12+,16-,17-;/m0./s1 |
| InChIKey | VZJFHMVEWALMEY-HEUNDTSPSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |