C22H25NO4 — CID 58112628
[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] cyclobutanecarboxylate (PubChem CID 58112628) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] cyclobutanecarboxylate.
| Compound Name | [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 58112628 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] cyclobutanecarboxylate |
| SMILES | CN1CC[C@]23c4c5ccc(OC(=O)C6CCC6)c4O[C@H]2C(=O)CCC3[C@H]1C5 |
| InChI | InChI=1S/C22H25NO4/c1-23-10-9-22-14-6-7-16(24)20(22)27-19-17(26-21(25)12-3-2-4-12)8-5-13(18(19)22)11-15(14)23/h5,8,12,14-15,20H,2-4,6-7,9-11H2,1H3/t14?,15-,20+,22+/m1/s1 |
| InChIKey | QQYYCZCTZFOYCV-CBNYFDLUSA-N |
| XLogP | 2.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|