C26H34N2O7S — CID 161250668
2-[[4-[[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid;sulfane (PubChem CID 161250668) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is 2-[[4-[[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid;sulfane.
| Compound Name | 2-[[4-[[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid;sulfane |
|---|---|
| PubChem CID | 161250668 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[[4-[[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid;sulfane |
| SMILES | CC(C)C(NC(=O)CCC(=O)Oc1ccc2c3c1O[C@H]1C(=O)CCC4[C@@H](C2)N(C)CC[C@@]341)C(=O)O.S |
| InChI | InChI=1S/C26H32N2O7.H2S/c1-13(2)22(25(32)33)27-19(30)8-9-20(31)34-18-7-4-14-12-16-15-5-6-17(29)24-26(15,10-11-28(16)3)21(14)23(18)35-24;/h4,7,13,15-16,22,24H,5-6,8-12H2,1-3H3,(H,27,30)(H,32,33);1H2/t15?,16-,22?,24+,26+;/m1./s1 |
| InChIKey | VBFNYCUBOPBVLA-ISELSJIQSA-N |
| XLogP | 1.95 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|