C27H36N2O7 — CID 89023313
2-[[4-[[(4R,7aR,12bS)-3,4,12-trimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 89023313) has the molecular formula C27H36N2O7 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-[[4-[[(4R,7aR,12bS)-3,4,12-trimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[[(4R,7aR,12bS)-3,4,12-trimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89023313 |
| Molecular Formula | C27H36N2O7 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-[[4-[[(4R,7aR,12bS)-3,4,12-trimethyl-7-oxo-2,4,4a,5,6,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-9-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | Cc1ccc(OC(=O)CCC(=O)NC(C(=O)O)C(C)C)c2c1[C@]13CCN(C)[C@H](C)C1CCC(=O)[C@@H]3O2 |
| InChI | InChI=1S/C27H36N2O7/c1-14(2)23(26(33)34)28-20(31)10-11-21(32)35-19-9-6-15(3)22-24(19)36-25-18(30)8-7-17-16(4)29(5)13-12-27(17,22)25/h6,9,14,16-17,23,25H,7-8,10-13H2,1-5H3,(H,28,31)(H,33,34)/t16-,17?,23?,25+,27+/m1/s1 |
| InChIKey | MPOLSIFPUFCGHD-CSMGYSAKSA-N |
| XLogP | 2.61 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|