C22H27NO5 — CID 58112625
[(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 2-methylpropyl carbonate (PubChem CID 58112625) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 2-methylpropyl carbonate.
| Compound Name | [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 58112625 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(4R,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)Oc1ccc2c3c1O[C@H]1C(=O)CCC4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C22H27NO5/c1-12(2)11-26-21(25)27-17-7-4-13-10-15-14-5-6-16(24)20-22(14,8-9-23(15)3)18(13)19(17)28-20/h4,7,12,14-15,20H,5-6,8-11H2,1-3H3/t14?,15-,20+,22+/m1/s1 |
| InChIKey | MNRKYCKKJOQUFM-CBNYFDLUSA-N |
| XLogP | 3.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|