C18H20N2O3 — CID 75054756
3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 75054756) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | 3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 75054756 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | CN1CCC23c4c5ccc(C(N)=O)c4OC2C(=O)CCC3C1C5 |
| InChI | InChI=1S/C18H20N2O3/c1-20-7-6-18-11-4-5-13(21)16(18)23-15-10(17(19)22)3-2-9(14(15)18)8-12(11)20/h2-3,11-12,16H,4-8H2,1H3,(H2,19,22) |
| InChIKey | BSIMUCFMGOYWKP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |