C23H35NO3Si2 — CID 57362225
[(4R,4aR,12bS)-3-methyl-7-trimethylsilyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-trimethylsilane (PubChem CID 57362225) has the molecular formula C23H35NO3Si2 and a molecular weight of 429.71 g/mol. Its IUPAC name is [(4R,4aR,12bS)-3-methyl-7-trimethylsilyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-trimethylsilane.
| Compound Name | [(4R,4aR,12bS)-3-methyl-7-trimethylsilyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 57362225 |
| Molecular Formula | C23H35NO3Si2 |
| Molecular Weight | 429.71 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [(4R,4aR,12bS)-3-methyl-7-trimethylsilyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-trimethylsilane |
| SMILES | CN1CC[C@]23c4c5ccc(O[Si](C)(C)C)c4OC2C(O[Si](C)(C)C)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H35NO3Si2/c1-24-13-12-23-16-9-11-19(27-29(5,6)7)22(23)25-21-18(26-28(2,3)4)10-8-15(20(21)23)14-17(16)24/h8-11,16-17,19,22H,12-14H2,1-7H3/t16-,17+,19?,22?,23-/m0/s1 |
| InChIKey | WGFFZYSWLVJOLB-IOFQHOHCSA-N |
| XLogP | 4.57 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|