C29H47NO3Si2 — CID 10951356
[(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10951356) has the molecular formula C29H47NO3Si2 and a molecular weight of 513.87 g/mol. Its IUPAC name is [(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10951356 |
| Molecular Formula | C29H47NO3Si2 |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | [(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CN1CC[C@]23c4c5ccc(O[Si](C)(C)C(C)(C)C)c4O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=C[C@@H]3[C@H]1C5 |
| InChI | InChI=1S/C29H47NO3Si2/c1-27(2,3)34(8,9)32-22-14-12-19-18-21-20-13-15-23(33-35(10,11)28(4,5)6)26-29(20,16-17-30(21)7)24(19)25(22)31-26/h12-15,20-21,23,26H,16-18H2,1-11H3/t20-,21-,23+,26+,29+/m1/s1 |
| InChIKey | GLIQITPFEISRJY-FWWMDLJFSA-N |
| XLogP | 6.91 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|