C28H45NO3Si2 — CID 69414903
[(4R,4aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 69414903) has the molecular formula C28H45NO3Si2 and a molecular weight of 499.84 g/mol. Its IUPAC name is [(4R,4aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,4aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 69414903 |
| Molecular Formula | C28H45NO3Si2 |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | [(4R,4aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c3c1OC1C(O[Si](C)(C)C(C)(C)C)C=C[C@H]4[C@@H](C2)NCC[C@]314 |
| InChI | InChI=1S/C28H45NO3Si2/c1-26(2,3)33(7,8)31-21-13-11-18-17-20-19-12-14-22(32-34(9,10)27(4,5)6)25-28(19,15-16-29-20)23(18)24(21)30-25/h11-14,19-20,22,25,29H,15-17H2,1-10H3/t19-,20+,22?,25?,28-/m0/s1 |
| InChIKey | MKWPVODTMONDOJ-QFMYBHIHSA-N |
| XLogP | 6.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|