C18H21NO3 — CID 118083842
(7aR,12bS)-7,9-dimethoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 118083842) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (7aR,12bS)-7,9-dimethoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (7aR,12bS)-7,9-dimethoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 118083842 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (7aR,12bS)-7,9-dimethoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COC1=CCC2C3Cc4ccc(OC)c5c4[C@@]2(CCN3)[C@H]1O5 |
| InChI | InChI=1S/C18H21NO3/c1-20-13-5-3-10-9-12-11-4-6-14(21-2)17-18(11,7-8-19-12)15(10)16(13)22-17/h3,5-6,11-12,17,19H,4,7-9H2,1-2H3/t11?,12?,17-,18-/m0/s1 |
| InChIKey | HUNBZOBAJPISSR-DFYNNNJYSA-N |
| XLogP | 2.16 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |