C19H23NO2 — CID 58589519
(7aR,12bS)-7-methoxy-3,9-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 58589519) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (7aR,12bS)-7-methoxy-3,9-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (7aR,12bS)-7-methoxy-3,9-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 58589519 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (7aR,12bS)-7-methoxy-3,9-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COC1=CCC2C3Cc4ccc(C)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C19H23NO2/c1-11-4-5-12-10-14-13-6-7-15(21-3)18-19(13,8-9-20(14)2)16(12)17(11)22-18/h4-5,7,13-14,18H,6,8-10H2,1-3H3/t13?,14?,18-,19-/m0/s1 |
| InChIKey | TYCYYCBOZXEDDW-IJWHBOBBSA-N |
| XLogP | 2.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |