C29H31NO10 — CID 85472862
[(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] benzoate;2,3-dihydroxybutanedioic acid (PubChem CID 85472862) has the molecular formula C29H31NO10 and a molecular weight of 553.56 g/mol. Its IUPAC name is [(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] benzoate;2,3-dihydroxybutanedioic acid.
| Compound Name | [(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] benzoate;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 85472862 |
| Molecular Formula | C29H31NO10 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] benzoate;2,3-dihydroxybutanedioic acid |
| SMILES | COc1ccc2c3c1O[C@H]1C(OC(=O)c4ccccc4)=CC[C@H]4[C@@H](C2)N(C)CC[C@]314.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C25H25NO4.C4H6O6/c1-26-13-12-25-17-9-11-20(29-24(27)15-6-4-3-5-7-15)23(25)30-22-19(28-2)10-8-16(21(22)25)14-18(17)26;5-1(3(7)8)2(6)4(9)10/h3-8,10-11,17-18,23H,9,12-14H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t17-,18+,23-,25-;/m0./s1 |
| InChIKey | XEEGHPKURQOKSK-RFIUKBLMSA-N |
| XLogP | 1.59 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |