C27H27NO4 — CID 58091688
[9-(hydroxymethyl)-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (E)-3-phenylprop-2-enoate (PubChem CID 58091688) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [9-(hydroxymethyl)-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [9-(hydroxymethyl)-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 58091688 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [9-(hydroxymethyl)-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CN1CCC23c4c5ccc(CO)c4OC2C(OC(=O)/C=C/c2ccccc2)=CCC3C1C5 |
| InChI | InChI=1S/C27H27NO4/c1-28-14-13-27-20-10-11-22(31-23(30)12-7-17-5-3-2-4-6-17)26(27)32-25-19(16-29)9-8-18(24(25)27)15-21(20)28/h2-9,11-12,20-21,26,29H,10,13-16H2,1H3/b12-7+ |
| InChIKey | FARHGWWZWZGMGP-KPKJPENVSA-N |
| XLogP | 3.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|