C22H30N2O4 — CID 58111622
(3R)-3-[[(12bR)-9-(hydroxymethyl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-1-hydroxybutan-2-one (PubChem CID 58111622) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (3R)-3-[[(12bR)-9-(hydroxymethyl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-1-hydroxybutan-2-one.
| Compound Name | (3R)-3-[[(12bR)-9-(hydroxymethyl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-1-hydroxybutan-2-one |
|---|---|
| PubChem CID | 58111622 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (3R)-3-[[(12bR)-9-(hydroxymethyl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-1-hydroxybutan-2-one |
| SMILES | C[C@@H](NC1CCC2C3Cc4ccc(CO)c5c4[C@]2(CCN3C)C1O5)C(=O)CO |
| InChI | InChI=1S/C22H30N2O4/c1-12(18(27)11-26)23-16-6-5-15-17-9-13-3-4-14(10-25)20-19(13)22(15,21(16)28-20)7-8-24(17)2/h3-4,12,15-17,21,23,25-26H,5-11H2,1-2H3/t12-,15?,16?,17?,21?,22-/m1/s1 |
| InChIKey | PEVHCYJHJCXTKX-GUQMTULWSA-N |
| XLogP | 0.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |