C25H27NO3 — CID 10762926
(4R,4aR,6R,7aR,12bS)-9-methoxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10762926) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (4R,4aR,6R,7aR,12bS)-9-methoxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,6R,7aR,12bS)-9-methoxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10762926 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (4R,4aR,6R,7aR,12bS)-9-methoxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)[C@@](C)(c4ccccc4)C[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C25H27NO3/c1-24(16-7-5-4-6-8-16)14-17-18-13-15-9-10-19(28-3)21-20(15)25(17,11-12-26(18)2)23(29-21)22(24)27/h4-10,17-18,23H,11-14H2,1-3H3/t17-,18+,23-,24+,25-/m0/s1 |
| InChIKey | KWYJNBTULYYASX-PKWKGPSUSA-N |
| XLogP | 3.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |