C24H25NO3 — CID 10714510
(4R,4aR,6R,7aR,12bS)-9-hydroxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10714510) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (4R,4aR,6R,7aR,12bS)-9-hydroxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,6R,7aR,12bS)-9-hydroxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10714510 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4R,4aR,6R,7aR,12bS)-9-hydroxy-3,6-dimethyl-6-phenyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)[C@@](C)(c2ccccc2)C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C24H25NO3/c1-23(15-6-4-3-5-7-15)13-16-17-12-14-8-9-18(26)20-19(14)24(16,10-11-25(17)2)22(28-20)21(23)27/h3-9,16-17,22,26H,10-13H2,1-2H3/t16-,17+,22-,23+,24-/m0/s1 |
| InChIKey | XNKDSHYPMWTWER-LBDDYCNWSA-N |
| XLogP | 3.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |