C23H29NO4 — CID 13065595
6-hexanoyl-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 13065595) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6-hexanoyl-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | 6-hexanoyl-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 13065595 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 6-hexanoyl-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CCCCCC(=O)C1CC2C3Cc4ccc(O)c5c4C2(CCN3C)C(O5)C1=O |
| InChI | InChI=1S/C23H29NO4/c1-3-4-5-6-17(25)14-12-15-16-11-13-7-8-18(26)21-19(13)23(15,9-10-24(16)2)22(28-21)20(14)27/h7-8,14-16,22,26H,3-6,9-12H2,1-2H3 |
| InChIKey | NTMSESUVSZGDEE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|