C18H22N4O3 — CID 177386246
[(E)-[(4R,4aR,12bS)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]urea (PubChem CID 177386246) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(E)-[(4R,4aR,12bS)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]urea.
| Compound Name | [(E)-[(4R,4aR,12bS)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]urea |
|---|---|
| PubChem CID | 177386246 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(E)-[(4R,4aR,12bS)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]urea |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4OC2/C(=N/NC(N)=O)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C18H22N4O3/c1-22-7-6-18-10-3-4-11(20-21-17(19)24)16(18)25-15-13(23)5-2-9(14(15)18)8-12(10)22/h2,5,10,12,16,23H,3-4,6-8H2,1H3,(H3,19,21,24)/b20-11+/t10-,12+,16?,18-/m0/s1 |
| InChIKey | NRGPTVHGHLKUPQ-PMGMMPJESA-N |
| XLogP | 1.09 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|