C19H23NO3 — CID 71108305
(4R,7aR,12bS)-7-methoxy-3,5-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 71108305) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (4R,7aR,12bS)-7-methoxy-3,5-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4R,7aR,12bS)-7-methoxy-3,5-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 71108305 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4R,7aR,12bS)-7-methoxy-3,5-dimethyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | COC1=CC(C)C2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C19H23NO3/c1-10-8-14(22-3)18-19-6-7-20(2)12(15(10)19)9-11-4-5-13(21)17(23-18)16(11)19/h4-5,8,10,12,15,18,21H,6-7,9H2,1-3H3/t10?,12-,15?,18+,19+/m1/s1 |
| InChIKey | ZVCNJJNWRWIERH-GKAIAHNJSA-N |
| XLogP | 2.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |