C20H26O3 — CID 134188571
(4S,4aR,7aS,12bS)-7,9-dimethoxy-4,12-dimethyl-2,3,4,4a,5,7a-hexahydro-1H-naphtho[1,8a-b][1]benzofuran (PubChem CID 134188571) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (4S,4aR,7aS,12bS)-7,9-dimethoxy-4,12-dimethyl-2,3,4,4a,5,7a-hexahydro-1H-naphtho[1,8a-b][1]benzofuran.
| Compound Name | (4S,4aR,7aS,12bS)-7,9-dimethoxy-4,12-dimethyl-2,3,4,4a,5,7a-hexahydro-1H-naphtho[1,8a-b][1]benzofuran |
|---|---|
| PubChem CID | 134188571 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4S,4aR,7aS,12bS)-7,9-dimethoxy-4,12-dimethyl-2,3,4,4a,5,7a-hexahydro-1H-naphtho[1,8a-b][1]benzofuran |
| SMILES | COC1=CC[C@@H]2[C@@H](C)CCC[C@@]23c2c(C)ccc(OC)c2O[C@H]13 |
| InChI | InChI=1S/C20H26O3/c1-12-6-5-11-20-14(12)8-10-16(22-4)19(20)23-18-15(21-3)9-7-13(2)17(18)20/h7,9-10,12,14,19H,5-6,8,11H2,1-4H3/t12-,14+,19+,20-/m0/s1 |
| InChIKey | SEGUIEBSPFCCSN-BZLSQUIXSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |