C23H22N2O4 — CID 147345973
(9-methoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) pyridine-3-carboxylate (PubChem CID 147345973) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (9-methoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) pyridine-3-carboxylate.
| Compound Name | (9-methoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) pyridine-3-carboxylate |
|---|---|
| PubChem CID | 147345973 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (9-methoxy-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) pyridine-3-carboxylate |
| SMILES | COc1ccc2c3c1OC1C(OC(=O)c4cccnc4)=CCC4C(C2)NCCC314 |
| InChI | InChI=1S/C23H22N2O4/c1-27-17-6-4-13-11-16-15-5-7-18(28-22(26)14-3-2-9-24-12-14)21-23(15,8-10-25-16)19(13)20(17)29-21/h2-4,6-7,9,12,15-16,21,25H,5,8,10-11H2,1H3 |
| InChIKey | DELBSIFEJQLOCQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |