C25H28N2O4 — CID 126486881
[(8Z,10Z)-10-methoxy-4-methyl-18-methylidene-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-8,10,14-trien-14-yl] pyridine-3-carboxylate (PubChem CID 126486881) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [(8Z,10Z)-10-methoxy-4-methyl-18-methylidene-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-8,10,14-trien-14-yl] pyridine-3-carboxylate.
| Compound Name | [(8Z,10Z)-10-methoxy-4-methyl-18-methylidene-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-8,10,14-trien-14-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126486881 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [(8Z,10Z)-10-methoxy-4-methyl-18-methylidene-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-8,10,14-trien-14-yl] pyridine-3-carboxylate |
| SMILES | C=C1/C2=C(OC)\C=C/CCC3C4CC=C(OC(=O)c5cccnc5)C(O2)C14CCN3C |
| InChI | InChI=1S/C25H28N2O4/c1-16-22-20(29-3)9-5-4-8-19-18-10-11-21(30-24(28)17-7-6-13-26-15-17)23(31-22)25(16,18)12-14-27(19)2/h5-7,9,11,13,15,18-19,23H,1,4,8,10,12,14H2,2-3H3/b9-5-,22-20+ |
| InChIKey | VBQKQAYZCKIBRB-MSUCLFPDSA-N |
| XLogP | 4.00 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |