C23H25N3O4 — CID 67803413
N-[(4R,4aR,7R,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyridine-3-carboxamide (PubChem CID 67803413) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(4R,4aR,7R,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4R,4aR,7R,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67803413 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(4R,4aR,7R,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyridine-3-carboxamide |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@](O)(NC(=O)c2cccnc2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H25N3O4/c1-26-10-8-22-15-6-7-23(29,25-20(28)14-3-2-9-24-12-14)21(22)30-19-17(27)5-4-13(18(19)22)11-16(15)26/h2-5,9,12,15-16,21,27,29H,6-8,10-11H2,1H3,(H,25,28)/t15-,16+,21+,22-,23+/m0/s1 |
| InChIKey | QDMZWBLTWBLKGJ-OEEPJNJMSA-N |
| XLogP | 1.57 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|