C11H14N2O2 — CID 152529548
[(3R)-1-methylpyrrolidin-3-yl] pyridine-3-carboxylate (PubChem CID 152529548) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is [(3R)-1-methylpyrrolidin-3-yl] pyridine-3-carboxylate.
| Compound Name | [(3R)-1-methylpyrrolidin-3-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 152529548 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(3R)-1-methylpyrrolidin-3-yl] pyridine-3-carboxylate |
| SMILES | CN1CC[C@@H](OC(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C11H14N2O2/c1-13-6-4-10(8-13)15-11(14)9-3-2-5-12-7-9/h2-3,5,7,10H,4,6,8H2,1H3/t10-/m1/s1 |
| InChIKey | YJGANGATIMJVGC-SNVBAGLBSA-N |
| XLogP | 0.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |