About (1-methylpiperidin-4-yl) 3-methylbenzoate chloride
(1-methylpiperidin-4-yl) 3-methylbenzoate chloride (PubChem CID 53347537) has the molecular formula C14H19ClNO2-
and a molecular weight of 268.76 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 3-methylbenzoate chloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 3-methylbenzoate chloride |
| PubChem CID | 53347537 |
| Molecular Formula | C14H19ClNO2- |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1-methylpiperidin-4-yl) 3-methylbenzoate chloride |
| SMILES | Cc1cccc(C(=O)OC2CCN(C)CC2)c1.[Cl-] |
| InChI | InChI=1S/C14H19NO2.ClH/c1-11-4-3-5-12(10-11)14(16)17-13-6-8-15(2)9-7-13;/h3-5,10,13H,6-9H2,1-2H3;1H/p-1 |
| InChIKey | CRNYPNIQOVAPNI-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) 3-methylbenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 3-methylbenzoate chloride?
The IUPAC name of (1-methylpiperidin-4-yl) 3-methylbenzoate chloride (CID 53347537) is (1-methylpiperidin-4-yl) 3-methylbenzoate chloride.
What is the SMILES notation for (1-methylpiperidin-4-yl) 3-methylbenzoate chloride?
The canonical SMILES for (1-methylpiperidin-4-yl) 3-methylbenzoate chloride is Cc1cccc(C(=O)OC2CCN(C)CC2)c1.[Cl-].
What is the InChIKey of (1-methylpiperidin-4-yl) 3-methylbenzoate chloride?
The InChIKey is CRNYPNIQOVAPNI-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H19NO2.ClH/c1-11-4-3-5-12(10-11)14(16)17-13-6-8-15(2)9-7-13;/h3-5,10,13H,6-9H2,1-2H3;1H/p-1.
What are the key properties of (1-methylpiperidin-4-yl) 3-methylbenzoate chloride?
(1-methylpiperidin-4-yl) 3-methylbenzoate chloride has a molecular weight of 268.76 g/mol, XLogP of -0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 3-methylbenzoate chloride is sourced from PubChem (CID 53347537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).