About oxan-2-yl 3-methylbenzoate
oxan-2-yl 3-methylbenzoate (PubChem CID 139991124) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is oxan-2-yl 3-methylbenzoate.
Molecular Properties
| Compound Name | oxan-2-yl 3-methylbenzoate |
| PubChem CID | 139991124 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | oxan-2-yl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC2CCCCO2)c1 |
| InChI | InChI=1S/C13H16O3/c1-10-5-4-6-11(9-10)13(14)16-12-7-2-3-8-15-12/h4-6,9,12H,2-3,7-8H2,1H3 |
| InChIKey | PWWFIDGOBWGZMX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-2-yl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-yl 3-methylbenzoate?
The IUPAC name of oxan-2-yl 3-methylbenzoate (CID 139991124) is oxan-2-yl 3-methylbenzoate.
What is the SMILES notation for oxan-2-yl 3-methylbenzoate?
The canonical SMILES for oxan-2-yl 3-methylbenzoate is Cc1cccc(C(=O)OC2CCCCO2)c1.
What is the InChIKey of oxan-2-yl 3-methylbenzoate?
The InChIKey is PWWFIDGOBWGZMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-10-5-4-6-11(9-10)13(14)16-12-7-2-3-8-15-12/h4-6,9,12H,2-3,7-8H2,1H3.
What are the key properties of oxan-2-yl 3-methylbenzoate?
oxan-2-yl 3-methylbenzoate has a molecular weight of 220.27 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl 3-methylbenzoate is sourced from PubChem (CID 139991124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).