C23H20O7 — CID 144860107
bis(oxolan-2-yl) 9-oxofluorene-2,7-dicarboxylate (PubChem CID 144860107) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is bis(oxolan-2-yl) 9-oxofluorene-2,7-dicarboxylate.
| Compound Name | bis(oxolan-2-yl) 9-oxofluorene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 144860107 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | bis(oxolan-2-yl) 9-oxofluorene-2,7-dicarboxylate |
| SMILES | O=C(OC1CCCO1)c1ccc2c(c1)C(=O)c1cc(C(=O)OC3CCCO3)ccc1-2 |
| InChI | InChI=1S/C23H20O7/c24-21-17-11-13(22(25)29-19-3-1-9-27-19)5-7-15(17)16-8-6-14(12-18(16)21)23(26)30-20-4-2-10-28-20/h5-8,11-12,19-20H,1-4,9-10H2 |
| InChIKey | VQDCZVDWNCQQDI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |