C30H26O10 — CID 178030655
[4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl]cyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 178030655) has the molecular formula C30H26O10 and a molecular weight of 546.53 g/mol. Its IUPAC name is [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl]cyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl]cyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 178030655 |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl]cyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(OC1CCC(C2CCC(OC(=O)c3ccc4c(c3)C(=O)OC4=O)CC2)CC1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C30H26O10/c31-25(17-5-11-21-23(13-17)29(35)39-27(21)33)37-19-7-1-15(2-8-19)16-3-9-20(10-4-16)38-26(32)18-6-12-22-24(14-18)30(36)40-28(22)34/h5-6,11-16,19-20H,1-4,7-10H2 |
| InChIKey | FBZIAINGTUGVQN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|