C25H9BO11 — CID 174076604
CID 174076604 (PubChem CID 174076604) has the molecular formula C25H9BO11 and a molecular weight of 496.15 g/mol.
| Compound Name | CID 174076604 |
|---|---|
| PubChem CID | 174076604 |
| Molecular Formula | C25H9BO11 |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | — |
| SMILES | [B]C(=O)c1cc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)cc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)c1 |
| InChI | InChI=1S/C25H9BO11/c26-19(27)12-5-13(34-20(28)10-1-3-15-17(7-10)24(32)36-22(15)30)9-14(6-12)35-21(29)11-2-4-16-18(8-11)25(33)37-23(16)31/h1-9H |
| InChIKey | MMEXDYYLCLGGHC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 156.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|