C18H6AlIO10 — CID 163483270
[(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-iodoalumanyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 163483270) has the molecular formula C18H6AlIO10 and a molecular weight of 536.12 g/mol. Its IUPAC name is [(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-iodoalumanyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-iodoalumanyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 163483270 |
| Molecular Formula | C18H6AlIO10 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.88 |
| IUPAC Name | [(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-iodoalumanyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(O[Al](I)OC(=O)c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/2C9H4O5.Al.HI/c2*10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;;/h2*1-3H,(H,10,11);;1H/q;;+3;/p-3 |
| InChIKey | CGJZUKZRWWGZRV-UHFFFAOYSA-K |
| XLogP | 1.74 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|