C36H26O10 — CID 58003181
[4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 58003181) has the molecular formula C36H26O10 and a molecular weight of 618.59 g/mol. Its IUPAC name is [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 58003181 |
| Molecular Formula | C36H26O10 |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | Cc1cc(-c2cc(C)c(OC(=O)c3ccc4c(c3)C(=O)OC4=O)c(C)c2C)c(C)c(C)c1OC(=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C36H26O10/c1-15-11-25(17(3)19(5)29(15)43-31(37)21-7-9-23-27(13-21)35(41)45-33(23)39)26-12-16(2)30(20(6)18(26)4)44-32(38)22-8-10-24-28(14-22)36(42)46-34(24)40/h7-14H,1-6H3 |
| InChIKey | CUNRPKKYDOINRS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|