C39H34N2O8 — CID 170245945
[4-[4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170245945) has the molecular formula C39H34N2O8 and a molecular weight of 658.71 g/mol. Its IUPAC name is [4-[4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170245945 |
| Molecular Formula | C39H34N2O8 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | [4-[4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxy-2,3,5-trimethylphenyl]-2,3,6-trimethylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCN1C(=O)c2ccc(C(=O)Oc3c(C)cc(-c4cc(C)c(OC(=O)c5ccc6c(c5)C(=O)N(C)C6=O)c(C)c4C)c(C)c3C)cc2C1=O |
| InChI | InChI=1S/C39H34N2O8/c1-9-41-36(44)27-13-11-25(17-31(27)37(41)45)39(47)49-33-19(3)15-29(21(5)23(33)7)28-14-18(2)32(22(6)20(28)4)48-38(46)24-10-12-26-30(16-24)35(43)40(8)34(26)42/h10-17H,9H2,1-8H3 |
| InChIKey | ZYYHBLFUPZUNRY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|