C14H11NO4 — CID 47362369
but-3-ynyl 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 47362369) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is but-3-ynyl 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | but-3-ynyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 47362369 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | but-3-ynyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C#CCCOC(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C14H11NO4/c1-3-4-7-19-14(18)9-5-6-10-11(8-9)13(17)15(2)12(10)16/h1,5-6,8H,4,7H2,2H3 |
| InChIKey | KHUMYTQKCRXDPO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|