C27H18N2O8 — CID 22949752
[4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 22949752) has the molecular formula C27H18N2O8 and a molecular weight of 498.45 g/mol. Its IUPAC name is [4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 22949752 |
| Molecular Formula | C27H18N2O8 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [4-(2-ethyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCN1C(=O)c2ccc(C(=O)Oc3ccc(OC(=O)c4ccc5c(c4)C(=O)N(C)C5=O)cc3)cc2C1=O |
| InChI | InChI=1S/C27H18N2O8/c1-3-29-24(32)19-11-5-15(13-21(19)25(29)33)27(35)37-17-8-6-16(7-9-17)36-26(34)14-4-10-18-20(12-14)23(31)28(2)22(18)30/h4-13H,3H2,1-2H3 |
| InChIKey | UMTNGNUJHNKHDB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|