C41H28N4O12 — CID 163569340
[4-[4-[4-[2-(aminomethyl)-1,3-dioxoisoindole-5-carbonyl]oxybenzoyl]oxy-3-methylphenoxy]carbonylphenyl] 2-(aminomethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 163569340) has the molecular formula C41H28N4O12 and a molecular weight of 768.69 g/mol. Its IUPAC name is [4-[4-[4-[2-(aminomethyl)-1,3-dioxoisoindole-5-carbonyl]oxybenzoyl]oxy-3-methylphenoxy]carbonylphenyl] 2-(aminomethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-[4-[2-(aminomethyl)-1,3-dioxoisoindole-5-carbonyl]oxybenzoyl]oxy-3-methylphenoxy]carbonylphenyl] 2-(aminomethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 163569340 |
| Molecular Formula | C41H28N4O12 |
| Molecular Weight | 768.69 g/mol |
| Exact Mass | 768.17 |
| IUPAC Name | [4-[4-[4-[2-(aminomethyl)-1,3-dioxoisoindole-5-carbonyl]oxybenzoyl]oxy-3-methylphenoxy]carbonylphenyl] 2-(aminomethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(OC(=O)c2ccc(OC(=O)c3ccc4c(c3)C(=O)N(CN)C4=O)cc2)ccc1OC(=O)c1ccc(OC(=O)c2ccc3c(c2)C(=O)N(CN)C3=O)cc1 |
| InChI | InChI=1S/C41H28N4O12/c1-21-16-28(56-38(50)22-2-8-26(9-3-22)54-40(52)24-6-13-29-31(17-24)36(48)44(19-42)34(29)46)12-15-33(21)57-39(51)23-4-10-27(11-5-23)55-41(53)25-7-14-30-32(18-25)37(49)45(20-43)35(30)47/h2-18H,19-20,42-43H2,1H3 |
| InChIKey | QOROPNSRLVYZJU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 232.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|