C20H17NO4 — CID 9097214
(3,4-dimethylphenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 9097214) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (3,4-dimethylphenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 9097214 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (3,4-dimethylphenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Oc3ccc(C)c(C)c3)cc2C1=O |
| InChI | InChI=1S/C20H17NO4/c1-4-9-21-18(22)16-8-6-14(11-17(16)19(21)23)20(24)25-15-7-5-12(2)13(3)10-15/h4-8,10-11H,1,9H2,2-3H3 |
| InChIKey | LHHTXNLCURCTJG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|