C18H12ClNO4 — CID 8766005
(3-chlorophenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 8766005) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is (3-chlorophenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (3-chlorophenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 8766005 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (3-chlorophenyl) 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Oc3cccc(Cl)c3)cc2C1=O |
| InChI | InChI=1S/C18H12ClNO4/c1-2-8-20-16(21)14-7-6-11(9-15(14)17(20)22)18(23)24-13-5-3-4-12(19)10-13/h2-7,9-10H,1,8H2 |
| InChIKey | CHGFBYKLRCNIKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|