C22H15NO4 — CID 16552078
naphthalen-2-yl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 16552078) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is naphthalen-2-yl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | naphthalen-2-yl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16552078 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | naphthalen-2-yl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Oc3ccc4ccccc4c3)cc2C1=O |
| InChI | InChI=1S/C22H15NO4/c1-2-11-23-20(24)18-10-8-16(13-19(18)21(23)25)22(26)27-17-9-7-14-5-3-4-6-15(14)12-17/h2-10,12-13H,1,11H2 |
| InChIKey | LECYRJQLZQFMPD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|