C36H24N2O8 — CID 67788470
[4-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 67788470) has the molecular formula C36H24N2O8 and a molecular weight of 612.59 g/mol. Its IUPAC name is [4-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [4-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 67788470 |
| Molecular Formula | C36H24N2O8 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | [4-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Oc3ccc(-c4ccc(OC(=O)c5ccc6c(c5)C(=O)N(CC=C)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C36H24N2O8/c1-3-17-37-31(39)27-15-9-23(19-29(27)33(37)41)35(43)45-25-11-5-21(6-12-25)22-7-13-26(14-8-22)46-36(44)24-10-16-28-30(20-24)34(42)38(18-4-2)32(28)40/h3-16,19-20H,1-2,17-18H2 |
| InChIKey | HBJGUXOVGKTRJN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|