C22H19NO7 — CID 7738579
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 7738579) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7738579 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCC(=O)c3ccc(OC)cc3OC)cc2C1=O |
| InChI | InChI=1S/C22H19NO7/c1-4-9-23-20(25)15-7-5-13(10-17(15)21(23)26)22(27)30-12-18(24)16-8-6-14(28-2)11-19(16)29-3/h4-8,10-11H,1,9,12H2,2-3H3 |
| InChIKey | WGQYVBUJUINMKA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|