C23H20O5 — CID 2520644
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-phenylbenzoate (PubChem CID 2520644) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-phenylbenzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 2520644 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-phenylbenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(-c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H20O5/c1-26-19-12-13-20(22(14-19)27-2)21(24)15-28-23(25)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-14H,15H2,1-2H3 |
| InChIKey | NZFODKOARHHEJL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |