C24H22O5 — CID 23993413
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-methylphenyl)benzoate (PubChem CID 23993413) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-methylphenyl)benzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 23993413 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-methylphenyl)benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(-c3ccc(C)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H22O5/c1-16-4-6-17(7-5-16)18-8-10-19(11-9-18)24(26)29-15-22(25)21-13-12-20(27-2)14-23(21)28-3/h4-14H,15H2,1-3H3 |
| InChIKey | SBIFXWVNWKLCIU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |