C23H20O6 — CID 7133589
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133589) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133589 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(-c3ccc(O)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H20O6/c1-27-19-11-12-20(22(13-19)28-2)21(25)14-29-23(26)17-5-3-15(4-6-17)16-7-9-18(24)10-8-16/h3-13,24H,14H2,1-2H3 |
| InChIKey | RQRJCHHILLARQR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |